4-N-(9-benzyl-2-chloropurin-6-yl)benzene-1,4-diamine structure
|
Common Name | 4-N-(9-benzyl-2-chloropurin-6-yl)benzene-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 125802-55-3 | Molecular Weight | 350.80500 | |
| Density | 1.43g/cm3 | Boiling Point | 552.4ºC at 760 mmHg | |
| Molecular Formula | C18H15ClN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.9ºC | |
| Name | 4-N-(9-benzyl-2-chloropurin-6-yl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 552.4ºC at 760 mmHg |
| Molecular Formula | C18H15ClN6 |
| Molecular Weight | 350.80500 |
| Flash Point | 287.9ºC |
| Exact Mass | 350.10500 |
| PSA | 81.65000 |
| LogP | 4.50800 |
| Vapour Pressure | 3.02E-12mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | LTWAAWMGZAVRBE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Nc2nc(Cl)nc3c2ncn3Cc2ccccc2)cc1 |
|
~61%
4-N-(9-benzyl-2... CAS#:125802-55-3 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Benzenediamine,N1-[2-chloro-9-(phenylmethyl)-9H-purin-6-yl] |
| 1,4-Benzenediamine,N-[2-chloro-9-(phenylmethyl)-9H-purin-6-yl]-(9CI) |
| 1,4-Benzenediamine,N-[2-chloro-9-(phenylmethyl)-9H-purin-6-yl] |