ethyl 4-(2-phenylphenoxy)butanimidate,hydrochloride structure
|
Common Name | ethyl 4-(2-phenylphenoxy)butanimidate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 125849-36-7 | Molecular Weight | 319.82600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(2-phenylphenoxy)butanimidate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22ClNO2 |
|---|---|
| Molecular Weight | 319.82600 |
| Exact Mass | 319.13400 |
| PSA | 42.31000 |
| LogP | 5.42810 |
| InChIKey | GFLIVIKRPBFXFB-UHFFFAOYSA-N |
| SMILES | CCOC(=N)CCCOc1ccccc1-c1ccccc1.Cl |
|
~94%
ethyl 4-(2-phen... CAS#:125849-36-7 |
| Literature: Cervena, Irena; Holubek, Jiri; Svatek, Emil; Metys, Jan; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1989 , vol. 54, # 7 p. 1966 - 1978 |
|
~%
ethyl 4-(2-phen... CAS#:125849-36-7 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 54, # 7 p. 1966 - 1978 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanimidic acid,4-([1,1'-biphenyl]-2-yloxy)-,ethyl ester,hydrochloride |