4-[3-[(4-carbamimidoylphenyl)amino]propylamino]benzenecarboximidamide structure
|
Common Name | 4-[3-[(4-carbamimidoylphenyl)amino]propylamino]benzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 125880-81-1 | Molecular Weight | 310.39700 | |
| Density | 1.26g/cm3 | Boiling Point | 559.5ºC at 760mmHg | |
| Molecular Formula | C17H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.2ºC | |
| Name | 4-[3-(4-carbamimidoylanilino)propylamino]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 559.5ºC at 760mmHg |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.39700 |
| Flash Point | 292.2ºC |
| Exact Mass | 310.19100 |
| PSA | 123.80000 |
| LogP | 3.91490 |
| Vapour Pressure | 1.51E-12mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ULZAPTUUAYXQCK-UHFFFAOYSA-N |
| SMILES | N=C(N)c1ccc(NCCCNc2ccc(C(=N)N)cc2)cc1 |
|
~%
4-[3-[(4-carbam... CAS#:125880-81-1 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
4-[3-[(4-carbam... CAS#:125880-81-1 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzenecarboximidamide,4,4'-(1,3-propanediyldiimino)bis-(9CI) |
| 4-[3-[(4-CARBAMIMIDOYLPHENYL)AMINO]PROPYLAMINO]BENZENECARBOXIMIDAMIDE |
| 1.3-Bis-<4-amidino-anilino>-propan |
| 1,3-Di(4-amidinophenylamino)propane |