1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid
Modify Date: 2026-07-06 20:02:16
![1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid Structure](https://www.chemsrc.com/extcaspic/414/1259063-76-7.png)
1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid structure
|
Common Name | 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1259063-76-7 | Molecular Weight | 251.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6FN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6FN3O4 |
|---|---|
| Molecular Weight | 251.17 |
| InChIKey | JSBRFNDIYDNYBY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nnn(-c2ccc(F)cc2)c1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1259063-76-7? |
| A: Chinese name of 1259063-76-7 is 1259063-76-7. |
| Q: What is the SMILES notation of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: SMILES notation of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is O=C(O)c1nnn(-c2ccc(F)cc2)c1C(=O)O. |
| Q: What is the molecular weight of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: Molecular weight of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is 251.17. |
| Q: What is the CAS number of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: CAS number of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is 1259063-76-7. |
| Q: What is the English name of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: The English name of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid. |
| Q: What is the molecular formula of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: Molecular formula of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is C10H6FN3O4. |
| Q: What is the InChIKey of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid? |
| A: InChIKey of 1-(4-Fluoro-phenyl)-1h-[1,2,3]triazole-4,5-dicarboxylic acid is JSBRFNDIYDNYBY-UHFFFAOYSA-N. |