Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate structure
|
Common Name | Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1259077-55-8 | Molecular Weight | 297.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9BrN2O3 |
|---|---|
| Molecular Weight | 297.10 |
| InChIKey | MXRFPTIOSLWHEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2c(Br)cncc2c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: InChIKey of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is MXRFPTIOSLWHEP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: Molecular formula of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is C11H9BrN2O3. |
| Q: What is the CAS number of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: CAS number of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is 1259077-55-8. |
| Q: What is the molecular weight of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: Molecular weight of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is 297.10. |
| Q: What is the SMILES notation of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: SMILES notation of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is CCOC(=O)c1c[nH]c2c(Br)cncc2c1=O. |
| Q: What is the English name of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate? |
| A: The English name of Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate is Ethyl 8-bromo-4-hydroxy-1,6-naphthyridine-3-carboxylate. |
| Q: What is the Chinese name of 1259077-55-8? |
| A: Chinese name of 1259077-55-8 is 1259077-55-8. |