3-Isoquinolinepropanoic acid, ethyl ester
Modify Date: 2026-07-10 20:04:45
3-Isoquinolinepropanoic acid, ethyl ester structure
|
Common Name | 3-Isoquinolinepropanoic acid, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1259078-85-7 | Molecular Weight | 229.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Isoquinolinepropanoic acid, ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.27 |
| InChIKey | QZMKBHOQGBQBKR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1cc2ccccc2cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1259078-85-7? |
| A: Chinese name of 1259078-85-7 is 1259078-85-7. |
| Q: What is the InChIKey of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: InChIKey of 3-Isoquinolinepropanoic acid, ethyl ester is QZMKBHOQGBQBKR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: CAS number of 3-Isoquinolinepropanoic acid, ethyl ester is 1259078-85-7. |
| Q: What is the English name of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: The English name of 3-Isoquinolinepropanoic acid, ethyl ester is 3-Isoquinolinepropanoic acid, ethyl ester. |
| Q: What is the molecular weight of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: Molecular weight of 3-Isoquinolinepropanoic acid, ethyl ester is 229.27. |
| Q: What is the SMILES notation of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: SMILES notation of 3-Isoquinolinepropanoic acid, ethyl ester is CCOC(=O)CCc1cc2ccccc2cn1. |
| Q: What is the molecular formula of 3-Isoquinolinepropanoic acid, ethyl ester? |
| A: Molecular formula of 3-Isoquinolinepropanoic acid, ethyl ester is C14H15NO2. |