5-Bromo-2,3-diphenyl-1H-indole structure
|
Common Name | 5-Bromo-2,3-diphenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 1259224-11-7 | Molecular Weight | 348.236 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 494.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H14BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8±25.4 °C | |
| Name | 5-Bromo-2,3-diphenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 494.3±33.0 °C at 760 mmHg |
| Molecular Formula | C20H14BrN |
| Molecular Weight | 348.236 |
| Flash Point | 252.8±25.4 °C |
| Exact Mass | 347.030945 |
| PSA | 15.79000 |
| LogP | 6.83 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | LALQILLMTIDLFI-UHFFFAOYSA-N |
| SMILES | Brc1ccc2[nH]c(-c3ccccc3)c(-c3ccccc3)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 5-bromo-2,3-diphenyl- |
| 5-Bromo-2,3-diphenyl-1H-indole |