4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester
Modify Date: 2025-09-09 18:36:58
![4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/206/1260381-48-3.png)
4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester structure
|
Common Name | 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1260381-48-3 | Molecular Weight | 208.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9FN2O2 |
|---|---|
| Molecular Weight | 208.19 |
| InChIKey | SWXOOENDOLMGDK-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cn2c(F)cccc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: InChIKey of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is SWXOOENDOLMGDK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1260381-48-3? |
| A: Chinese name of 1260381-48-3 is 1260381-48-3. |
| Q: What is the English name of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: The English name of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester. |
| Q: What is the molecular weight of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: Molecular weight of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 208.19. |
| Q: What is the SMILES notation of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: SMILES notation of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is COC(=O)Cc1cn2c(F)cccc2n1. |
| Q: What is the CAS number of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: CAS number of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 1260381-48-3. |
| Q: What is the molecular formula of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: Molecular formula of 4-Fluoroimidazo[1,2-a]pyridin-2-acetic acid methyl ester is C10H9FN2O2. |