5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester
Modify Date: 2026-07-18 17:59:04
![5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/236/1260382-07-7.png)
5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester structure
|
Common Name | 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1260382-07-7 | Molecular Weight | 456.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10I2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10I2N2O2 |
|---|---|
| Molecular Weight | 456.02 |
| InChIKey | FOGAKNICUMRBJX-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cn2c(C)c(I)cc(I)c2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: InChIKey of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is FOGAKNICUMRBJX-UHFFFAOYSA-N. |
| Q: What is the English name of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: The English name of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester. |
| Q: What is the SMILES notation of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: SMILES notation of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is COC(=O)Cc1cn2c(C)c(I)cc(I)c2n1. |
| Q: What is the Chinese name of 1260382-07-7? |
| A: Chinese name of 1260382-07-7 is 1260382-07-7. |
| Q: What is the molecular formula of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: Molecular formula of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is C11H10I2N2O2. |
| Q: What is the molecular weight of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: Molecular weight of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 456.02. |
| Q: What is the CAS number of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester? |
| A: CAS number of 5,7-Diiodo-4-methylimidazo[1,2-a]pyridin-2-acetic acid methyl ester is 1260382-07-7. |