N-methyl-N-(t-Boc)-PEG4-acid structure
|
Common Name | N-methyl-N-(t-Boc)-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 1260431-01-3 | Molecular Weight | 379.446 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 488.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H33NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.1±28.7 °C | |
Use of N-methyl-N-(t-Boc)-PEG4-acidN-Methyl-N-(t-Boc)-PEG4-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-methyl-N-(t-Boc)-PEG4-acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Methyl-N-(t-Boc)-PEG4-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.2±45.0 °C at 760 mmHg |
| Molecular Formula | C17H33NO8 |
| Molecular Weight | 379.446 |
| Flash Point | 249.1±28.7 °C |
| Exact Mass | 379.220612 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.470 |
| InChIKey | SZYFMMNWNDIBGM-UHFFFAOYSA-N |
| SMILES | CN(CCOCCOCCOCCOCCC(=O)O)C(=O)OC(C)(C)C |
| 2,2,5-Trimethyl-4-oxo-3,8,11,14,17-pentaoxa-5-azaicosan-20-oic acid |
| MFCD28950776 |
| 3,8,11,14,17-Pentaoxa-5-azaeicosan-20-oic acid, 2,2,5-trimethyl-4-oxo- |