5-METHYL-1-(3-TRIFLUOROMETHYL-PHENYL)-1H-PYRAZOLE-3-CARBOXYLICACID structure
|
Common Name | 5-METHYL-1-(3-TRIFLUOROMETHYL-PHENYL)-1H-PYRAZOLE-3-CARBOXYLICACID | ||
|---|---|---|---|---|
| CAS Number | 126067-60-5 | Molecular Weight | 270.20700 | |
| Density | 1.4g/cm3 | Boiling Point | 386.1ºC at 760 mmHg | |
| Molecular Formula | C12H9F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.3ºC | |
| Name | 5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylic acid |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 386.1ºC at 760 mmHg |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.20700 |
| Flash Point | 187.3ºC |
| Exact Mass | 270.06200 |
| PSA | 55.12000 |
| LogP | 2.89770 |
| Vapour Pressure | 1.19E-06mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | QMDOPJDETJJZEG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)nn1-c1cccc(C(F)(F)F)c1 |
| HS Code | 2933199090 |
|---|
|
~%
5-METHYL-1-(3-T... CAS#:126067-60-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 17 p. 2287 - 2290 |
|
~%
5-METHYL-1-(3-T... CAS#:126067-60-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 17 p. 2287 - 2290 |
|
~%
5-METHYL-1-(3-T... CAS#:126067-60-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 11, # 17 p. 2287 - 2290 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |