1-(2,4-DICHLOROPHENOXY)PROPAN-2-OL structure
|
Common Name | 1-(2,4-DICHLOROPHENOXY)PROPAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 126067-88-7 | Molecular Weight | 271.09900 | |
| Density | 1.5g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C11H8Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | 1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.09900 |
| Flash Point | 219ºC |
| Exact Mass | 269.99600 |
| PSA | 55.12000 |
| LogP | 3.18570 |
| Vapour Pressure | 1.83E-08mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | KGCCBXHSOMDSPJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)nn1-c1ccc(Cl)cc1Cl |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |