Methyl 2-oxo-7-(trifluoromethyl)indoline-4-carboxylate structure
|
Common Name | Methyl 2-oxo-7-(trifluoromethyl)indoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1260676-89-8 | Molecular Weight | 259.181 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 386.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4±27.9 °C | |
| Name | methyl 2-oxo-7-(trifluoromethyl)-1,3-dihydroindole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.2±42.0 °C at 760 mmHg |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.181 |
| Flash Point | 187.4±27.9 °C |
| Exact Mass | 259.045624 |
| PSA | 58.89000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | KOSKZAOZNPIPNG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(F)(F)F)c2c1CC(=O)N2 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1H-Indole-4-carboxylic acid, 2,3-dihydro-2-oxo-7-(trifluoromethyl)-, methyl ester |
| Methyl 2-oxo-7-(trifluoromethyl)-4-indolinecarboxylate |
| methyl 2-oxo-7-(trifluoromethyl)indoline-4-carboxylate |