Diethyl 3,3'-(5-(4-methoxybenzyl)-1,3-phenylene)dipropanoate structure
|
Common Name | Diethyl 3,3'-(5-(4-methoxybenzyl)-1,3-phenylene)dipropanoate | ||
|---|---|---|---|---|
| CAS Number | 1260763-78-7 | Molecular Weight | 398.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-[3-(3-ethoxy-3-oxopropyl)-5-[(4-methoxyphenyl)methyl]phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H30O5 |
|---|---|
| Molecular Weight | 398.49200 |
| Exact Mass | 398.20900 |
| PSA | 61.83000 |
| LogP | 4.27740 |
| InChIKey | WYLRQNNAHLOAJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1cc(CCC(=O)OCC)cc(Cc2ccc(OC)cc2)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diethyl 3,3'-(5-(4-methoxybenzyl)-1,3-phenylene)dipropanoate |