3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine
Modify Date: 2025-09-09 13:01:27
![3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine Structure](https://www.chemsrc.com/extcaspic/390/1260768-64-6.png)
3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine structure
|
Common Name | 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 1260768-64-6 | Molecular Weight | 247.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12F3NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12F3NS |
|---|---|
| Molecular Weight | 247.28 |
| InChIKey | RJHSZGJHOMIUCD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Sc1ccc(C2CCNC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: Molecular formula of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is C11H12F3NS. |
| Q: What is the English name of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: The English name of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine. |
| Q: What is the molecular weight of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: Molecular weight of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is 247.28. |
| Q: What is the SMILES notation of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: SMILES notation of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is FC(F)(F)Sc1ccc(C2CCNC2)cc1. |
| Q: What is the Chinese name of 1260768-64-6? |
| A: Chinese name of 1260768-64-6 is 1260768-64-6. |
| Q: What is the InChIKey of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: InChIKey of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is RJHSZGJHOMIUCD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine? |
| A: CAS number of 3-{4-[(Trifluoromethyl)sulfanyl]phenyl}pyrrolidine is 1260768-64-6. |