Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)
Modify Date: 2026-07-06 12:14:14
Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) structure
|
Common Name | Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) | ||
|---|---|---|---|---|
| CAS Number | 1260815-98-2 | Molecular Weight | 233.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO2 |
|---|---|
| Molecular Weight | 233.31 |
| InChIKey | MENNYCCCXBBJJD-UHFFFAOYSA-N |
| SMILES | C=CCc1cc(C2CCNC2)cc(OC)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: CAS number of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is 1260815-98-2. |
| Q: What is the Chinese name of 1260815-98-2? |
| A: Chinese name of 1260815-98-2 is 1260815-98-2. |
| Q: What is the English name of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: The English name of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl). |
| Q: What is the molecular weight of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: Molecular weight of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is 233.31. |
| Q: What is the SMILES notation of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: SMILES notation of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is C=CCc1cc(C2CCNC2)cc(OC)c1O. |
| Q: What is the InChIKey of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: InChIKey of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is MENNYCCCXBBJJD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl)? |
| A: Molecular formula of Phenol, 2-methoxy-6-(2-propen-1-yl)-4-(3-pyrrolidinyl) is C14H19NO2. |