Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]
Modify Date: 2025-08-28 10:02:20
![Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] Structure](https://www.chemsrc.com/extcaspic/480/1260860-65-8.png)
Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] structure
|
Common Name | Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1260860-65-8 | Molecular Weight | 237.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20ClN |
|---|---|
| Molecular Weight | 237.77 |
| InChIKey | BJAHVEUIQQKAMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Cl)c(C2CCNC2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: Molecular formula of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is C14H20ClN. |
| Q: What is the English name of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: The English name of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]. |
| Q: What is the SMILES notation of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: SMILES notation of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is CC(C)(C)c1ccc(Cl)c(C2CCNC2)c1. |
| Q: What is the CAS number of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: CAS number of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is 1260860-65-8. |
| Q: What is the molecular weight of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: Molecular weight of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is 237.77. |
| Q: What is the Chinese name of 1260860-65-8? |
| A: Chinese name of 1260860-65-8 is 1260860-65-8. |
| Q: What is the InChIKey of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl]? |
| A: InChIKey of Pyrrolidine, 3-[2-chloro-5-(1,1-dimethylethyl)phenyl] is BJAHVEUIQQKAMH-UHFFFAOYSA-N. |