1-(Methylseleno)-2,4-dinitrobenzene
Modify Date: 2025-09-05 12:09:24
1-(Methylseleno)-2,4-dinitrobenzene structure
|
Common Name | 1-(Methylseleno)-2,4-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 126104-07-2 | Molecular Weight | 261.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6N2O4Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Methylseleno)-2,4-dinitrobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6N2O4Se |
|---|---|
| Molecular Weight | 261.10 |
| InChIKey | FVYFEAWMCLVYQV-UHFFFAOYSA-N |
| SMILES | C[Se]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: The English name of 1-(Methylseleno)-2,4-dinitrobenzene is 1-(Methylseleno)-2,4-dinitrobenzene. |
| Q: What is the molecular formula of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: Molecular formula of 1-(Methylseleno)-2,4-dinitrobenzene is C7H6N2O4Se. |
| Q: What is the InChIKey of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: InChIKey of 1-(Methylseleno)-2,4-dinitrobenzene is FVYFEAWMCLVYQV-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 126104-07-2? |
| A: Chinese name of 126104-07-2 is 126104-07-2. |
| Q: What is the CAS number of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: CAS number of 1-(Methylseleno)-2,4-dinitrobenzene is 126104-07-2. |
| Q: What is the molecular weight of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: Molecular weight of 1-(Methylseleno)-2,4-dinitrobenzene is 261.10. |
| Q: What is the SMILES notation of 1-(Methylseleno)-2,4-dinitrobenzene? |
| A: SMILES notation of 1-(Methylseleno)-2,4-dinitrobenzene is C[Se]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |