3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine
Modify Date: 2026-07-03 16:50:26
![3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine Structure](https://www.chemsrc.com/extcaspic/488/1261443-57-5.png)
3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine structure
|
Common Name | 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1261443-57-5 | Molecular Weight | 289.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8F5NO |
|---|---|
| Molecular Weight | 289.20 |
| InChIKey | JCVNOQWKMVJFCD-UHFFFAOYSA-N |
| SMILES | Nc1c(F)cc(F)cc1-c1ccc(OC(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: CAS number of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is 1261443-57-5. |
| Q: What is the Chinese name of 1261443-57-5? |
| A: Chinese name of 1261443-57-5 is 1261443-57-5. |
| Q: What is the molecular weight of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: Molecular weight of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is 289.20. |
| Q: What is the molecular formula of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: Molecular formula of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is C13H8F5NO. |
| Q: What is the InChIKey of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: InChIKey of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is JCVNOQWKMVJFCD-UHFFFAOYSA-N. |
| Q: What is the English name of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: The English name of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine. |
| Q: What is the SMILES notation of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine? |
| A: SMILES notation of 3,5-Difluoro-4'-(trifluoromethoxy)-[1,1'-biphenyl]-2-amine is Nc1c(F)cc(F)cc1-c1ccc(OC(F)(F)F)cc1. |