Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy
Modify Date: 2026-08-07 17:14:47
Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy structure
|
Common Name | Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy | ||
|---|---|---|---|---|
| CAS Number | 1261473-84-0 | Molecular Weight | 256.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6BrNO3 |
|---|---|
| Molecular Weight | 256.05 |
| InChIKey | VYEOPKNOJWINAP-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Br)cc(C(O)C(=O)O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: InChIKey of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is VYEOPKNOJWINAP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1261473-84-0? |
| A: Chinese name of 1261473-84-0 is 1261473-84-0. |
| Q: What is the molecular formula of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: Molecular formula of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is C9H6BrNO3. |
| Q: What is the CAS number of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: CAS number of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is 1261473-84-0. |
| Q: What is the English name of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: The English name of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy. |
| Q: What is the SMILES notation of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: SMILES notation of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is N#Cc1cc(Br)cc(C(O)C(=O)O)c1. |
| Q: What is the molecular weight of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy? |
| A: Molecular weight of Benzeneacetic acid, 3-bromo-5-cyano-I+/--hydroxy is 256.05. |