3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl
Modify Date: 2026-08-20 12:44:19
3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl structure
|
Common Name | 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1261554-01-1 | Molecular Weight | 287.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9ClF3NO |
|---|---|
| Molecular Weight | 287.66 |
| InChIKey | QOVFZFGZPLJCKU-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc(-c2ccccc2OC(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: CAS number of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is 1261554-01-1. |
| Q: What is the English name of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: The English name of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl. |
| Q: What is the SMILES notation of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: SMILES notation of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is Nc1cc(Cl)cc(-c2ccccc2OC(F)(F)F)c1. |
| Q: What is the molecular formula of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: Molecular formula of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is C13H9ClF3NO. |
| Q: What is the InChIKey of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: InChIKey of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is QOVFZFGZPLJCKU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl? |
| A: Molecular weight of 3-Amino-5-chloro-2'-(trifluoromethoxy)biphenyl is 287.66. |
| Q: What is the Chinese name of 1261554-01-1? |
| A: Chinese name of 1261554-01-1 is 1261554-01-1. |