3-Methoxy-2-(trifluoromethyl)benzoyl chloride
Modify Date: 2025-11-25 20:20:20
3-Methoxy-2-(trifluoromethyl)benzoyl chloride structure
|
Common Name | 3-Methoxy-2-(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1261618-61-4 | Molecular Weight | 238.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methoxy-2-(trifluoromethyl)benzoyl chloride |
|---|
| Molecular Formula | C9H6ClF3O2 |
|---|---|
| Molecular Weight | 238.59100 |
| Exact Mass | 238.00100 |
| PSA | 26.30000 |
| LogP | 3.09300 |
| InChIKey | BUMLWUIFYAZAJN-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)Cl)c1C(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |