2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester
Modify Date: 2026-08-12 21:27:16
2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester structure
|
Common Name | 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1261663-41-5 | Molecular Weight | 254.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8F2O2S |
|---|---|
| Molecular Weight | 254.25 |
| InChIKey | ZJSRRKBVXYYVIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sccc1-c1cccc(F)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: SMILES notation of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is COC(=O)c1sccc1-c1cccc(F)c1F. |
| Q: What is the molecular formula of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: Molecular formula of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is C12H8F2O2S. |
| Q: What is the molecular weight of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: Molecular weight of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is 254.25. |
| Q: What is the Chinese name of 1261663-41-5? |
| A: Chinese name of 1261663-41-5 is 1261663-41-5. |
| Q: What is the InChIKey of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: InChIKey of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is ZJSRRKBVXYYVIJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: CAS number of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is 1261663-41-5. |
| Q: What is the English name of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester? |
| A: The English name of 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester is 2-Thiophenecarboxylic acid, 3-(2,3-difluorophenyl)-, methyl ester. |