5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester
Modify Date: 2025-08-28 00:48:41
5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester structure
|
Common Name | 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1261663-45-9 | Molecular Weight | 314.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10F4O3 |
|---|---|
| Molecular Weight | 314.23 |
| InChIKey | KCWIIKQXHXVNKY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(F)cc(-c2cccc(OC(F)(F)F)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: The English name of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester. |
| Q: What is the molecular formula of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: Molecular formula of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is C15H10F4O3. |
| Q: What is the CAS number of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: CAS number of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is 1261663-45-9. |
| Q: What is the SMILES notation of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: SMILES notation of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is COC(=O)c1cc(F)cc(-c2cccc(OC(F)(F)F)c2)c1. |
| Q: What is the InChIKey of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: InChIKey of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is KCWIIKQXHXVNKY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester? |
| A: Molecular weight of 5-Fluoro-3'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester is 314.23. |
| Q: What is the Chinese name of 1261663-45-9? |
| A: Chinese name of 1261663-45-9 is 1261663-45-9. |