2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]
Modify Date: 2025-09-10 19:09:28
![2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] Structure](https://www.chemsrc.com/extcaspic/053/1261663-88-0.png)
2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] structure
|
Common Name | 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 1261663-88-0 | Molecular Weight | 309.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6F3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H6F3N3O3 |
|---|---|
| Molecular Weight | 309.20 |
| InChIKey | XVMSSZZVIJDKHE-UHFFFAOYSA-N |
| SMILES | N#Cc1ncc(-c2ccccc2OC(F)(F)F)cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: SMILES notation of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is N#Cc1ncc(-c2ccccc2OC(F)(F)F)cc1[N+](=O)[O-]. |
| Q: What is the English name of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: The English name of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]. |
| Q: What is the CAS number of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: CAS number of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is 1261663-88-0. |
| Q: What is the Chinese name of 1261663-88-0? |
| A: Chinese name of 1261663-88-0 is 1261663-88-0. |
| Q: What is the molecular weight of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: Molecular weight of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is 309.20. |
| Q: What is the molecular formula of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: Molecular formula of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is C13H6F3N3O3. |
| Q: What is the InChIKey of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl]? |
| A: InChIKey of 2-Pyridinecarbonitrile, 3-nitro-5-[2-(trifluoromethoxy)phenyl] is XVMSSZZVIJDKHE-UHFFFAOYSA-N. |