4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine
Modify Date: 2025-09-09 21:44:05
4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine structure
|
Common Name | 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 1261779-61-6 | Molecular Weight | 324.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6Cl2F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H6Cl2F3N3O |
|---|---|
| Molecular Weight | 324.08 |
| InChIKey | MYVHXXSCPWXYSL-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c(-c2cccc(OC(F)(F)F)c2)c(Cl)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: SMILES notation of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is Nc1nc(Cl)c(-c2cccc(OC(F)(F)F)c2)c(Cl)n1. |
| Q: What is the InChIKey of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: InChIKey of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is MYVHXXSCPWXYSL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1261779-61-6? |
| A: Chinese name of 1261779-61-6 is 1261779-61-6. |
| Q: What is the molecular formula of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: Molecular formula of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is C11H6Cl2F3N3O. |
| Q: What is the English name of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: The English name of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine. |
| Q: What is the CAS number of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: CAS number of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is 1261779-61-6. |
| Q: What is the molecular weight of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine? |
| A: Molecular weight of 4,6-Dichloro-5-(3-(trifluoromethoxy)phenyl)pyrimidin-2-amine is 324.08. |