2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl structure
|
Common Name | 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 1261823-75-9 | Molecular Weight | 322.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8ClF5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8ClF5O |
|---|---|
| Molecular Weight | 322.66 |
| InChIKey | VYJITKIYZBDFFS-UHFFFAOYSA-N |
| SMILES | FC(F)Oc1cccc(-c2ccccc2C(F)(F)F)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1261823-75-9? |
| A: Chinese name of 1261823-75-9 is 1261823-75-9. |
| Q: What is the molecular formula of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular formula of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is C14H8ClF5O. |
| Q: What is the InChIKey of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: InChIKey of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is VYJITKIYZBDFFS-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: The English name of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl. |
| Q: What is the SMILES notation of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: SMILES notation of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is FC(F)Oc1cccc(-c2ccccc2C(F)(F)F)c1Cl. |
| Q: What is the CAS number of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: CAS number of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is 1261823-75-9. |
| Q: What is the molecular weight of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl? |
| A: Molecular weight of 2-Chloro-3-(difluoromethoxy)-2'-(trifluoromethyl)-1,1'-biphenyl is 322.66. |