Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)
Modify Date: 2026-07-06 11:28:26
Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) structure
|
Common Name | Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 1261826-35-0 | Molecular Weight | 224.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4ClF3O2 |
|---|---|
| Molecular Weight | 224.56 |
| InChIKey | LYYNPOGSJQJLEU-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1c(O)cccc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: The English name of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl). |
| Q: What is the molecular formula of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: Molecular formula of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is C8H4ClF3O2. |
| Q: What is the InChIKey of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: InChIKey of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is LYYNPOGSJQJLEU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1261826-35-0? |
| A: Chinese name of 1261826-35-0 is 1261826-35-0. |
| Q: What is the SMILES notation of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: SMILES notation of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is O=C(Cl)c1c(O)cccc1C(F)(F)F. |
| Q: What is the CAS number of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: CAS number of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is 1261826-35-0. |
| Q: What is the molecular weight of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl)? |
| A: Molecular weight of Benzoyl chloride, 2-hydroxy-6-(trifluoromethyl) is 224.56. |