2-(furan-2-yl)-4-nitrobenzoic acid
2-(furan-2-yl)-4-nitrobenzoic acid structure
|
Common Name | 2-(furan-2-yl)-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1261908-82-0 | Molecular Weight | 233.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(furan-2-yl)-4-nitrobenzoic acid (CAS number: 1261908-82-0), molecular formula: C11H7NO5, molecular weight: 233.17700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(furan-2-yl)-4-nitrobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7NO5 |
|---|---|
| Molecular Weight | 233.17700 |
| Exact Mass | 233.03200 |
| PSA | 96.26000 |
| LogP | 3.07620 |
| InChIKey | ONXSLLKYDVDVJQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1-c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: LogP of 2-(furan-2-yl)-4-nitrobenzoic acid is 3.07620. |
| Q: What is the InChIKey of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: InChIKey of 2-(furan-2-yl)-4-nitrobenzoic acid is ONXSLLKYDVDVJQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: Molecular weight of 2-(furan-2-yl)-4-nitrobenzoic acid is 233.17700. |
| Q: What is the English name of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: The English name of 2-(furan-2-yl)-4-nitrobenzoic acid is 2-(furan-2-yl)-4-nitrobenzoic acid. |
| Q: What is the molecular formula of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: Molecular formula of 2-(furan-2-yl)-4-nitrobenzoic acid is C11H7NO5. |
| Q: What is the CAS number of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: CAS number of 2-(furan-2-yl)-4-nitrobenzoic acid is 1261908-82-0. |
| Q: What is the polar surface area (PSA) of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: Polar surface area (PSA) of 2-(furan-2-yl)-4-nitrobenzoic acid is 96.26000. |
| Q: What is the SMILES notation of 2-(furan-2-yl)-4-nitrobenzoic acid? |
| A: SMILES notation of 2-(furan-2-yl)-4-nitrobenzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1-c1ccco1. |
| Q: What is the Chinese name of 1261908-82-0? |
| A: Chinese name of 1261908-82-0 is 1261908-82-0. |