2-(2-hydroxyphenyl)-6-methylbenzoic acid structure
|
Common Name | 2-(2-hydroxyphenyl)-6-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1261979-04-7 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxyphenyl)-6-methylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 57.53000 |
| LogP | 3.06580 |
| InChIKey | AJNWJOKFWDGSLY-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2ccccc2O)c1C(=O)O |
|
~79%
2-(2-hydroxyphe... CAS#:1261979-04-7 |
| Literature: Gallardo-Donaire, Joan; Martin, Ruben Journal of the American Chemical Society, 2013 , vol. 135, # 25 p. 9350 - 9353 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2'-hydroxy-3-methyl-[1,1'-biphenyl]-2-carboxylic acid |