Stannane,tetrakis(2-methyl-2-phenylpropyl)- structure
|
Common Name | Stannane,tetrakis(2-methyl-2-phenylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 1262-78-8 | Molecular Weight | 651.54200 | |
| Density | N/A | Boiling Point | 649.1ºC at 760 mmHg | |
| Molecular Formula | C40H52Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333ºC | |
| Name | tetrakis(2-methyl-2-phenylpropyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 649.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C40H52Sn |
| Molecular Weight | 651.54200 |
| Flash Point | 333ºC |
| Exact Mass | 652.30900 |
| LogP | 11.34640 |
| Vapour Pressure | 5.12E-16mmHg at 25°C |
| InChIKey | HFCIGWLFXFUKOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C[Sn](CC(C)(C)c1ccccc1)(CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetraneophyltin |
| EINECS 215-028-0 |