(S)-4-Formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid
(S)-4-Formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid structure
|
Common Name | (S)-4-Formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 12624-18-9 | Molecular Weight | 211.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9NO5 |
|---|---|
| Molecular Weight | 211.17100 |
| Exact Mass | 211.04800 |
| PSA | 103.70000 |
| InChIKey | SRDYVCBFNUJKKW-ZETCQYMHSA-N |
| SMILES | O=CC1=CC=C(C(=O)O)NC(C(=O)O)C1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid |
| Muscaflavin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: Polar surface area (PSA) of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is 103.70000. |
| Q: What is the molecular formula of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: Molecular formula of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is C9H9NO5. |
| Q: What is the SMILES notation of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: SMILES notation of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is O=CC1=CC=C(C(=O)O)NC(C(=O)O)C1. |
| Q: What is the molecular weight of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: Molecular weight of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is 211.17100. |
| Q: What is the English name of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: The English name of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid. |
| Q: What English synonyms does (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid have? |
| A: English synonyms of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid: 4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid, Muscaflavin. |
| Q: What is the InChIKey of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: InChIKey of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is SRDYVCBFNUJKKW-ZETCQYMHSA-N. |
| Q: What is the CAS number of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid? |
| A: CAS number of (2S)-4-formyl-2,3-dihydro-1H-azepine-2,7-dicarboxylic acid is 12624-18-9. |
| Q: What is the Chinese name of 12624-18-9? |
| A: Chinese name of 12624-18-9 is 12624-18-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |