2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one
Modify Date: 2025-08-30 13:03:23
2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one structure
|
Common Name | 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 1262775-04-1 | Molecular Weight | 321.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3Cl6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H3Cl6NO2 |
|---|---|
| Molecular Weight | 321.8 |
| InChIKey | PMRPYKMXVGTYRU-UHFFFAOYSA-N |
| SMILES | O=C1NC(C(Cl)(Cl)Cl)OC1C(Cl)(Cl)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1262775-04-1? |
| A: Chinese name of 1262775-04-1 is 1262775-04-1. |
| Q: What is the molecular weight of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: Molecular weight of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is 321.8. |
| Q: What is the CAS number of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: CAS number of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is 1262775-04-1. |
| Q: What is the molecular formula of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: Molecular formula of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is C5H3Cl6NO2. |
| Q: What is the SMILES notation of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: SMILES notation of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is O=C1NC(C(Cl)(Cl)Cl)OC1C(Cl)(Cl)Cl. |
| Q: What is the English name of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: The English name of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one. |
| Q: What is the InChIKey of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one? |
| A: InChIKey of 2,5-Bis(trichloromethyl)-1,3-oxazolidin-4-one is PMRPYKMXVGTYRU-UHFFFAOYSA-N. |