Spirolaxine structure
|
Common Name | Spirolaxine | ||
|---|---|---|---|---|
| CAS Number | 126382-01-2 | Molecular Weight | 404.49700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SpirolaxineSpirolaxine is a plant growth inhibitor and possess significant anti-Helicobacter pylori activity. Spirolaxine exhibits cholesterol-lowering activity[1]. |
| Name | Spirolaxine |
|---|---|
| Synonym | More Synonyms |
| Description | Spirolaxine is a plant growth inhibitor and possess significant anti-Helicobacter pylori activity. Spirolaxine exhibits cholesterol-lowering activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| References |
| Molecular Formula | C23H32O6 |
|---|---|
| Molecular Weight | 404.49700 |
| Exact Mass | 404.22000 |
| PSA | 74.22000 |
| LogP | 5.02710 |
| InChIKey | CZIMFHQXGMXDMO-DGROVODQSA-N |
| SMILES | COc1cc(O)cc2c1C(=O)OC2CCCCCC1CCCC2(CCC(C)O2)O1 |
| 5-Hydroxy-7-methoxy-3-[5-(2-methyl-1,6-dioxa-spiro[4.5]dec-7-yl)-pentyl]-3H-isobenzofuran-1-one |