benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium
Modify Date: 2025-09-24 13:57:26
![benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium Structure](https://www.chemsrc.com/extcaspic/106/126441-52-9.png)
benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium structure
|
Common Name | benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium | ||
|---|---|---|---|---|
| CAS Number | 126441-52-9 | Molecular Weight | 293.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26O2P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26O2P+ |
|---|---|
| Molecular Weight | 293.4 |
| InChIKey | XZIOLTYUJMTHDQ-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C(O[P+](=O)Cc2ccccc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 126441-52-9? |
| A: Chinese name of 126441-52-9 is 126441-52-9. |
| Q: What is the InChIKey of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: InChIKey of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is XZIOLTYUJMTHDQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: Molecular weight of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is 293.4. |
| Q: What is the CAS number of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: CAS number of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is 126441-52-9. |
| Q: What is the English name of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: The English name of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium. |
| Q: What is the SMILES notation of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: SMILES notation of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is CC1CCC(C(C)C)C(O[P+](=O)Cc2ccccc2)C1. |
| Q: What is the molecular formula of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium? |
| A: Molecular formula of benzyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-oxophosphanium is C17H26O2P+. |