2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid
Modify Date: 2025-11-21 13:22:58
![2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid Structure](https://www.chemsrc.com/extcaspic/046/1265895-04-2.png)
2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid structure
|
Common Name | 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1265895-04-2 | Molecular Weight | 212.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12N2O4 |
|---|---|
| Molecular Weight | 212.20 |
| InChIKey | RQAJOIWYHHIEMR-UHFFFAOYSA-N |
| SMILES | O=C(O)COCc1cc2n(n1)CCCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: InChIKey of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is RQAJOIWYHHIEMR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: Molecular weight of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is 212.20. |
| Q: What is the molecular formula of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: Molecular formula of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is C9H12N2O4. |
| Q: What is the SMILES notation of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: SMILES notation of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is O=C(O)COCc1cc2n(n1)CCCO2. |
| Q: What is the CAS number of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: CAS number of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is 1265895-04-2. |
| Q: What is the Chinese name of 1265895-04-2? |
| A: Chinese name of 1265895-04-2 is 1265895-04-2. |
| Q: What is the English name of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid? |
| A: The English name of 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid is 2-((6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)methoxy)acetic acid. |