tert-butyl-(4-chlorophenoxy)-dimethylsilane
Modify Date: 2025-12-29 09:12:01
tert-butyl-(4-chlorophenoxy)-dimethylsilane structure
|
Common Name | tert-butyl-(4-chlorophenoxy)-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 126644-72-2 | Molecular Weight | 242.81700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19ClOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl-(4-chlorophenoxy)-dimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19ClOSi |
|---|---|
| Molecular Weight | 242.81700 |
| Exact Mass | 242.08900 |
| PSA | 9.23000 |
| LogP | 4.72400 |
| InChIKey | GIJYKQZUGLZCKZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 5 | |
CAS#:18162-48-6
CAS#:106-48-9
CAS#:37170-48-2
CAS#:1836-74-4
CAS#:876-27-7
CAS#:5257-08-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 126644-72-2? |
| A: Chinese name of 126644-72-2 is 126644-72-2. |
| Q: What are the upstream materials of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: Related upstream materials(CAS) of tert-butyl-(4-chlorophenoxy)-dimethylsilane: 18162-48-6;106-48-9. |
| Q: What is the English name of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: The English name of tert-butyl-(4-chlorophenoxy)-dimethylsilane is tert-butyl-(4-chlorophenoxy)-dimethylsilane. |
| Q: What is the InChIKey of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: InChIKey of tert-butyl-(4-chlorophenoxy)-dimethylsilane is GIJYKQZUGLZCKZ-UHFFFAOYSA-N. |
| Q: What is the LogP of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: LogP of tert-butyl-(4-chlorophenoxy)-dimethylsilane is 4.72400. |
| Q: What is the CAS number of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: CAS number of tert-butyl-(4-chlorophenoxy)-dimethylsilane is 126644-72-2. |
| Q: What is the molecular formula of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: Molecular formula of tert-butyl-(4-chlorophenoxy)-dimethylsilane is C12H19ClOSi. |
| Q: What is the SMILES notation of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: SMILES notation of tert-butyl-(4-chlorophenoxy)-dimethylsilane is CC(C)(C)[Si](C)(C)Oc1ccc(Cl)cc1. |
| Q: What is the molecular weight of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: Molecular weight of tert-butyl-(4-chlorophenoxy)-dimethylsilane is 242.81700. |
| Q: What is the polar surface area (PSA) of tert-butyl-(4-chlorophenoxy)-dimethylsilane? |
| A: Polar surface area (PSA) of tert-butyl-(4-chlorophenoxy)-dimethylsilane is 9.23000. |