Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo
Modify Date: 2025-11-10 13:21:15
![Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo Structure](https://www.chemsrc.com/extcaspic/373/1267305-02-1.png)
Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo structure
|
Common Name | Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo | ||
|---|---|---|---|---|
| CAS Number | 1267305-02-1 | Molecular Weight | 277.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO3 |
|---|---|
| Molecular Weight | 277.36 |
| InChIKey | NIMULKMJPRKOAH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(CCC(C)(C)NC(=O)C(=O)O)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: CAS number of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is 1267305-02-1. |
| Q: What is the SMILES notation of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: SMILES notation of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is Cc1cc(C)c(CCC(C)(C)NC(=O)C(=O)O)c(C)c1. |
| Q: What is the English name of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: The English name of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo. |
| Q: What is the Chinese name of 1267305-02-1? |
| A: Chinese name of 1267305-02-1 is 1267305-02-1. |
| Q: What is the molecular weight of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: Molecular weight of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is 277.36. |
| Q: What is the InChIKey of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: InChIKey of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is NIMULKMJPRKOAH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo? |
| A: Molecular formula of Acetic acid, 2-[[1,1-dimethyl-3-(2,4,6-trimethylphenyl)propyl]amino]-2-oxo is C16H23NO3. |