Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy
Modify Date: 2026-08-27 11:08:35
Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy structure
|
Common Name | Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 1268008-17-8 | Molecular Weight | 257.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17F2NO2 |
|---|---|
| Molecular Weight | 257.28 |
| InChIKey | SMHOLKBEVCYGHI-UHFFFAOYSA-N |
| SMILES | CCNC(=O)CCCC(O)c1ccc(F)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: CAS number of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is 1268008-17-8. |
| Q: What is the molecular weight of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: Molecular weight of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is 257.28. |
| Q: What is the English name of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: The English name of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy. |
| Q: What is the molecular formula of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: Molecular formula of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is C13H17F2NO2. |
| Q: What is the InChIKey of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: InChIKey of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is SMHOLKBEVCYGHI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy? |
| A: SMILES notation of Benzenepentanamide, N-ethyl-3,4-difluoro-I-hydroxy is CCNC(=O)CCCC(O)c1ccc(F)c(F)c1. |
| Q: What is the Chinese name of 1268008-17-8? |
| A: Chinese name of 1268008-17-8 is 1268008-17-8. |