3-BROMO-4-NITROINDOLE structure
|
Common Name | 3-BROMO-4-NITROINDOLE | ||
|---|---|---|---|---|
| CAS Number | 126807-08-7 | Molecular Weight | 241.04100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-bromo-4-nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5BrN2O2 |
|---|---|
| Molecular Weight | 241.04100 |
| Exact Mass | 239.95300 |
| PSA | 61.61000 |
| LogP | 3.36180 |
| Index of Refraction | 1.747 |
| InChIKey | VYQRPDVMVMLVHA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2[nH]cc(Br)c12 |
| HS Code | 2933990090 |
|---|
|
~%
3-BROMO-4-NITRO... CAS#:126807-08-7 |
| Literature: HANMI PHARM. CO., LTD.; BANG, Keuk Chan; PARK, Chang Hee; CHOI, Jae Yul; KIM, Seo Hee; HAM, Young Jin Patent: WO2014/3483 A1, 2014 ; Location in patent: Page/Page column 38 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-4-nitroindole |
| 1H-Indole,3-bromo-4-nitro |