Bis-PEG9-acid structure
|
Common Name | Bis-PEG9-acid | ||
|---|---|---|---|---|
| CAS Number | 1268488-70-5 | Molecular Weight | 514.561 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 630.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H42O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.6±25.0 °C | |
Use of Bis-PEG9-acidBis-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Bis-PEG9-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Bis-PEG10-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG9-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. Bis-PEG9-acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Cleavable |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.0±55.0 °C at 760 mmHg |
| Molecular Formula | C22H42O13 |
| Molecular Weight | 514.561 |
| Flash Point | 201.6±25.0 °C |
| Exact Mass | 514.262512 |
| LogP | -3.33 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | MZPXCHJGEDEJHQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| Storage condition | 2-8°C |
| HOOCCH2CH2-PEG24-CH2CH2COOH |