Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]
Modify Date: 2026-08-31 12:59:37
![Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] Structure](https://www.chemsrc.com/extcaspic/237/1268614-44-3.png)
Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] structure
|
Common Name | Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] | ||
|---|---|---|---|---|
| CAS Number | 1268614-44-3 | Molecular Weight | 237.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15N3 |
|---|---|
| Molecular Weight | 237.30 |
| InChIKey | UAQMGDVATRGXEW-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=Cc1ccccc1CN1CCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: Molecular formula of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is C15H15N3. |
| Q: What is the CAS number of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: CAS number of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is 1268614-44-3. |
| Q: What is the English name of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: The English name of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]. |
| Q: What is the molecular weight of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: Molecular weight of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is 237.30. |
| Q: What is the InChIKey of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: InChIKey of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is UAQMGDVATRGXEW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1268614-44-3? |
| A: Chinese name of 1268614-44-3 is 1268614-44-3. |
| Q: What is the SMILES notation of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene]? |
| A: SMILES notation of Propanedinitrile, 2-[[2-(1-pyrrolidinylmethyl)phenyl]methylene] is N#CC(C#N)=Cc1ccccc1CN1CCCC1. |