2,3,4,5-TETRAHYDRO-8-METHOXY-1H-PYRIDO[4,3-B]INDOLE structure
|
Common Name | 2,3,4,5-TETRAHYDRO-8-METHOXY-1H-PYRIDO[4,3-B]INDOLE | ||
|---|---|---|---|---|
| CAS Number | 126912-70-7 | Molecular Weight | 202.25200 | |
| Density | 1.198g/cm3 | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | 8-Methoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 388.6ºC at 760 mmHg |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.25200 |
| Flash Point | 188.8ºC |
| Exact Mass | 202.11100 |
| PSA | 37.05000 |
| LogP | 2.15100 |
| Vapour Pressure | 3.03E-06mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | HWQBIEUTTWNYFT-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3c(c2c1)CNCC3 |
| HS Code | 2933990090 |
|---|
|
~86%
2,3,4,5-TETRAHY... CAS#:126912-70-7 |
| Literature: Bonjoch, Josep; Diaba, Faiza; Pages, Lluis; Perez, Daniel; Soca, Lidia; Miralpeix, Montserrat; Vilella, Dolors; Anton, Paquita; Puig, Carles Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 15 p. 4299 - 4302 |
|
~%
2,3,4,5-TETRAHY... CAS#:126912-70-7 |
| Literature: WO2005/95397 A1, ; Page/Page column 44 ; WO 2005/095397 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-methoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |