2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine
Modify Date: 2026-09-22 07:52:33
![2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine Structure](https://www.chemsrc.com/extcaspic/491/1269293-99-3.png)
2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine structure
|
Common Name | 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 1269293-99-3 | Molecular Weight | 217.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10F3N3 |
|---|---|
| Molecular Weight | 217.19 |
| InChIKey | WVKKIFCNUXUXCJ-UHFFFAOYSA-N |
| SMILES | C=Cc1c(C(F)(F)F)nc2n1CCNC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: InChIKey of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is WVKKIFCNUXUXCJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: SMILES notation of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is C=Cc1c(C(F)(F)F)nc2n1CCNC2. |
| Q: What is the English name of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: The English name of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine. |
| Q: What is the Chinese name of 1269293-99-3? |
| A: Chinese name of 1269293-99-3 is 1269293-99-3. |
| Q: What is the molecular weight of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: Molecular weight of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is 217.19. |
| Q: What is the molecular formula of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: Molecular formula of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is C9H10F3N3. |
| Q: What is the CAS number of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine? |
| A: CAS number of 2-(Trifluoromethyl)-3-vinyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine is 1269293-99-3. |