Karavoate F
Modify Date: 2026-06-28 10:13:10
Karavoate F structure
|
Common Name | Karavoate F | ||
|---|---|---|---|---|
| CAS Number | 1269766-59-7 | Molecular Weight | 612.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H64O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Karavoate F |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C39H64O5 |
|---|---|
| Molecular Weight | 612.9 |
| InChIKey | GCSGWQIIVZDSSY-FQJWPJOCSA-N |
| SMILES | CCCC(=O)O[C@H]1CC[C@@H]2C(=C[C@@H]([C@@H]3[C@]2(CC[C@]4([C@]3(CC[C@@H]4[C@H](C)C[C@H](C=C(C)C)OC(=O)CCC)C)C)C)OC)C1(C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 19, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Karavoate F? |
| A: Molecular formula of Karavoate F is C39H64O5. |
| Q: What is the InChIKey of Karavoate F? |
| A: InChIKey of Karavoate F is GCSGWQIIVZDSSY-FQJWPJOCSA-N. |
| Q: What is the CAS number of Karavoate F? |
| A: CAS number of Karavoate F is 1269766-59-7. |
| Q: What is the Chinese name of 1269766-59-7? |
| A: Chinese name of 1269766-59-7 is 1269766-59-7. |
| Q: What is the English name of Karavoate F? |
| A: The English name of Karavoate F is Karavoate F. |
| Q: What is the molecular weight of Karavoate F? |
| A: Molecular weight of Karavoate F is 612.9. |
| Q: What is the SMILES notation of Karavoate F? |
| A: SMILES notation of Karavoate F is CCCC(=O)O[C@H]1CC[C@@H]2C(=C[C@@H]([C@@H]3[C@]2(CC[C@]4([C@]3(CC[C@@H]4[C@H](C)C[C@H](C=C(C)C)OC(=O)CCC)C)C)C)OC)C1(C)C. |