(1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL
Modify Date: 2025-08-26 10:07:05
![(1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL Structure](https://www.chemsrc.com/extcaspic/253/1269809-60-0.png)
(1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL structure
|
Common Name | (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL | ||
|---|---|---|---|---|
| CAS Number | 1269809-60-0 | Molecular Weight | 219.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12F3NO |
|---|---|
| Molecular Weight | 219.20 |
| InChIKey | RHMFFVGFZDRSPL-IMTBSYHQSA-N |
| SMILES | CC(O)C(N)c1ccc(C(F)(F)F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: The English name of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL. |
| Q: What is the SMILES notation of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: SMILES notation of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is CC(O)C(N)c1ccc(C(F)(F)F)cc1. |
| Q: What is the Chinese name of 1269809-60-0? |
| A: Chinese name of 1269809-60-0 is 1269809-60-0. |
| Q: What is the InChIKey of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: InChIKey of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is RHMFFVGFZDRSPL-IMTBSYHQSA-N. |
| Q: What is the molecular formula of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: Molecular formula of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is C10H12F3NO. |
| Q: What is the CAS number of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: CAS number of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is 1269809-60-0. |
| Q: What is the molecular weight of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL? |
| A: Molecular weight of (1S,2S)-1-Amino-1-[4-(trifluoromethyl)phenyl]propan-2-OL is 219.20. |