Solupront structure
|
Common Name | Solupront | ||
|---|---|---|---|---|
| CAS Number | 127-81-1 | Molecular Weight | 415.48300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25N3O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-aminophenyl)sulfonylamino]methanesulfonic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H25N3O8S2 |
|---|---|
| Molecular Weight | 415.48300 |
| Exact Mass | 415.10800 |
| PSA | 207.25000 |
| LogP | 0.79140 |
| InChIKey | PBJVVSIWWBZKBJ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)NCS(=O)(=O)O)cc1.OCCN(CCO)CCO |
| Sulfanilamidomethanesulfonic acid triethanolamine salt |
| p-Aminobenzenesulfonylaminomethanesulfonic acid triethanolamine salt |
| 4-Aminophenylsulfonylaminomethanesulfonic acid triethanolamine salt |
| Solupront |
| Salthion |
| Sulfanilamidomethanesulfonic acid salt with 2,2',2''-nitrilotriethanol |
| Methanesulfonic acid,sulfanilamido-,salt with 2,2',2''-nitrilotriethanol |