1-(2-(3-methoxyphenyl)ethyl)phenoxy-3-(dimethylamino)-2-propanol structure
|
Common Name | 1-(2-(3-methoxyphenyl)ethyl)phenoxy-3-(dimethylamino)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 127003-40-1 | Molecular Weight | 331.44900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(dimethylamino)-3-[1-[2-(3-methoxyphenyl)ethyl]cyclohexa-2,4-dien-1-yl]oxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H29NO3 |
|---|---|
| Molecular Weight | 331.44900 |
| Exact Mass | 331.21500 |
| PSA | 41.93000 |
| LogP | 2.82180 |
| Vapour Pressure | 1.59E-09mmHg at 25°C |
| InChIKey | AREPHAPHABGCQP-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCc2ccccc2OCC(O)CN(C)C)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(2-(3-Methoxyphenyl)ethyl)phenoxy-3-(dimethylamino)-2-propanol |