4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo
Modify Date: 2026-07-14 05:31:38
4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo structure
|
Common Name | 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo | ||
|---|---|---|---|---|
| CAS Number | 1270372-18-3 | Molecular Weight | 247.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11BrN2O2 |
|---|---|
| Molecular Weight | 247.09 |
| InChIKey | YOKAFLJKPMJCKY-UHFFFAOYSA-N |
| SMILES | COCC(N)c1c[nH]cc(Br)c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: The English name of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo. |
| Q: What is the InChIKey of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: InChIKey of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is YOKAFLJKPMJCKY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: Molecular formula of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is C8H11BrN2O2. |
| Q: What is the Chinese name of 1270372-18-3? |
| A: Chinese name of 1270372-18-3 is 1270372-18-3. |
| Q: What is the SMILES notation of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: SMILES notation of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is COCC(N)c1c[nH]cc(Br)c1=O. |
| Q: What is the CAS number of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: CAS number of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is 1270372-18-3. |
| Q: What is the molecular weight of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo? |
| A: Molecular weight of 4-Pyridinol, 3-(1-amino-2-methoxyethyl)-5-bromo is 247.09. |