Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl
Modify Date: 2026-07-23 18:04:40
Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl structure
|
Common Name | Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl | ||
|---|---|---|---|---|
| CAS Number | 1270478-40-4 | Molecular Weight | 250.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10Cl3N |
|---|---|
| Molecular Weight | 250.5 |
| InChIKey | QKTOCWMXWFCGHV-UHFFFAOYSA-N |
| SMILES | NC(c1ccc(Cl)c(Cl)c1Cl)C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: InChIKey of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is QKTOCWMXWFCGHV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: Molecular formula of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is C10H10Cl3N. |
| Q: What is the CAS number of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: CAS number of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is 1270478-40-4. |
| Q: What is the English name of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: The English name of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl. |
| Q: What is the SMILES notation of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: SMILES notation of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is NC(c1ccc(Cl)c(Cl)c1Cl)C1CC1. |
| Q: What is the Chinese name of 1270478-40-4? |
| A: Chinese name of 1270478-40-4 is 1270478-40-4. |
| Q: What is the molecular weight of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl? |
| A: Molecular weight of Benzenemethanamine, 2,3,4-trichloro-I+/--cyclopropyl is 250.5. |